CAS 2747917-88-8 is the registry number for Methocarbamol-13C,d3. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
[2-hydroxy-3-[2-(trideuterio(113C)methoxy)phenoxy]propyl] carbamate (CAS 2747917-88-8) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 245.25 g/mol. IUPAC name: [2-hydroxy-3-[2-(trideuterio(113C)methoxy)phenoxy]propyl] carbamate. InChIKey: GNXFOGHNGIVQEH-KQORAOOSSA-N.
| Molecular formula | C11H15NO5 |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | [2-hydroxy-3-[2-(trideuterio(113C)methoxy)phenoxy]propyl] carbamate |
| InChIKey | GNXFOGHNGIVQEH-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=CC=CC=C1OCC(COC(=O)N)O |
Computed by PubChem (NCBI)