Products 91248-60-1

CAS 91248-60-1 is the registry number for Diethyl 2-amino-5-methylfuran-3,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 10g, 5g.

Structural formula: {0} (CAS {1})

Diethyl 2-amino-5-methylfuran-3,4-dicarboxylate (CAS 91248-60-1) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. IUPAC name: diethyl 2-amino-5-methylfuran-3,4-dicarboxylate. InChIKey: KJHBLQGLKJXASY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO5
Molecular weight241.24 g/mol
IUPAC namediethyl 2-amino-5-methylfuran-3,4-dicarboxylate
InChIKeyKJHBLQGLKJXASY-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(OC(=C1C(=O)OCC)N)C

Computed by PubChem (NCBI)