Products 5035-82-5
CAS 5035-82-5 appears in our catalog under these names: Methyl 2-amino-3,4,5-trimethoxybenzoate, 98%, Methyl 2-Amino-3,4,5-trimethoxybenzoate, Methyl 2-amino-3,4,5-trimethoxybenzoate, 98%, 98%. Offered by: Combi-blocks, TRC, Chemat. Available pack sizes: 5g, 1g, 100mg, 10mg, 50mg, 250mg.
Methyl 2-amino-3,4,5-trimethoxybenzoate (CAS 5035-82-5) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. IUPAC name: methyl 2-amino-3,4,5-trimethoxybenzoate. InChIKey: UPVUQELOASQBMY-UHFFFAOYSA-N.
| Molecular formula | C11H15NO5 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | methyl 2-amino-3,4,5-trimethoxybenzoate |
| InChIKey | UPVUQELOASQBMY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)OC)N)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Methyl 3,4,5-trimethoxyanthranilate, Benzoic acid, 2-amino-3,4,5-trimethoxy-, methyl ester, InChI=1/C11H15NO5/c1-14-7-5-6(11(13)17-4)8(12)10(16-3)9(7)15-2/h5H,12H2,1-4H, Methyl 2-amino-3,4,5-trimethoxybenzoate, Maybridge1_001467, Oprea1_505329, 2-amino-3,4,5-trimethoxyBenzoic acid methyl ester, methyl 2-amino-3,4,5-trimethoxy-benzoate, Anthranilic acid, 3,4,5-trimethoxy-, methyl ester