Products 114843-08-2
CAS 114843-08-2 appears in our catalog under these names: 3-Amino-1-phenylpropan-1-ol oxalate, 95%, 3-Amino-1-phenylpropan-1-ol oxalate 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
3-amino-1-phenylpropan-1-ol;oxalic acid (CAS 114843-08-2) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. IUPAC name: 3-amino-1-phenylpropan-1-ol;oxalic acid. InChIKey: UDOSHWIDUCMPHW-UHFFFAOYSA-N.
| Molecular formula | C11H15NO5 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 3-amino-1-phenylpropan-1-ol;oxalic acid |
| InChIKey | UDOSHWIDUCMPHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCN)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)