Products 1189717-77-8

CAS 1189717-77-8 is the registry number for 1-(4-Methoxyphenyl)-1-phenylethanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

1-(4-methoxyphenyl)-1-phenylethanamine;hydrochloride (CAS 1189717-77-8) is a chemical compound with the molecular formula C15H18ClNO and a molecular weight of 263.76 g/mol. IUPAC name: 1-(4-methoxyphenyl)-1-phenylethanamine;hydrochloride. InChIKey: SKDCSFQPXSXGJB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18ClNO
Molecular weight263.76 g/mol
IUPAC name1-(4-methoxyphenyl)-1-phenylethanamine;hydrochloride
InChIKeySKDCSFQPXSXGJB-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)N.Cl

Computed by PubChem (NCBI)