CAS 1417570-04-7 is the registry number for (3-[(2,4-Dimethylphenoxy)methyl]phenyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[(2,4-dimethylphenoxy)methyl]aniline;hydrochloride (CAS 1417570-04-7) is a chemical compound with the molecular formula C15H18ClNO and a molecular weight of 263.76 g/mol. IUPAC name: 3-[(2,4-dimethylphenoxy)methyl]aniline;hydrochloride. InChIKey: SRXARHVXOHSDEQ-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO |
|---|---|
| Molecular weight | 263.76 g/mol |
| IUPAC name | 3-[(2,4-dimethylphenoxy)methyl]aniline;hydrochloride |
| InChIKey | SRXARHVXOHSDEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC2=CC(=CC=C2)N)C.Cl |
Computed by PubChem (NCBI)