Products 1258641-26-7
CAS 1258641-26-7 appears in our catalog under these names: 2-Methyl-4-[(3-methylphenyl)methoxy]aniline hydrochloride, 95%, 2-Methyl-4-((3-methylphenyl)methoxy)aniline hydrochloride, 95%, 2-Methyl-4-((3-methylphenyl)methoxy)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-methyl-4-[(3-methylphenyl)methoxy]aniline;hydrochloride (CAS 1258641-26-7) is a chemical compound with the molecular formula C15H18ClNO and a molecular weight of 263.76 g/mol. IUPAC name: 2-methyl-4-[(3-methylphenyl)methoxy]aniline;hydrochloride. InChIKey: XSIMPOHCMVBPQI-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO |
|---|---|
| Molecular weight | 263.76 g/mol |
| IUPAC name | 2-methyl-4-[(3-methylphenyl)methoxy]aniline;hydrochloride |
| InChIKey | XSIMPOHCMVBPQI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)COC2=CC(=C(C=C2)N)C.Cl |
Computed by PubChem (NCBI)