Products 924873-02-9
CAS 924873-02-9 is the registry number for 3-Chloro-1-(1,3,3-trimethyl-2,3-dihydro-1h-indol-2-ylidene)butan-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(1Z)-3-chloro-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one (CAS 924873-02-9) is a chemical compound with the molecular formula C15H18ClNO and a molecular weight of 263.76 g/mol. IUPAC name: (1Z)-3-chloro-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one. InChIKey: KUGWBNVGENNEAT-ZROIWOOFSA-N.
| Molecular formula | C15H18ClNO |
|---|---|
| Molecular weight | 263.76 g/mol |
| IUPAC name | (1Z)-3-chloro-1-(1,3,3-trimethylindol-2-ylidene)butan-2-one |
| InChIKey | KUGWBNVGENNEAT-ZROIWOOFSA-N |
| SMILES | CC(C(=O)/C=C\1/C(C2=CC=CC=C2N1C)(C)C)Cl |
Computed by PubChem (NCBI)