CAS 2982-54-9 appears in our catalog under these names: 2-(4-Benzyloxy-phenyl)-ethylamine hydrochloride, 98%, 2–(4–(benzyloxy)phenyl)ethan–1–amine hydrochloride, 4-Benzyloxy-Phenethylamine hydrochloride, Benzeneethanamine, 4-(phenylmethoxy)-, hydrochloride (1:1), 95%, 95%, 4-Benzyloxy-Phenethylamine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
2-(4-phenylmethoxyphenyl)ethanamine;hydrochloride (CAS 2982-54-9) is a chemical compound with the molecular formula C15H18ClNO and a molecular weight of 263.76 g/mol. IUPAC name: 2-(4-phenylmethoxyphenyl)ethanamine;hydrochloride. InChIKey: GMEWDNMRTKWSEF-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO |
|---|---|
| Molecular weight | 263.76 g/mol |
| IUPAC name | 2-(4-phenylmethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | GMEWDNMRTKWSEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CCN.Cl |
Computed by PubChem (NCBI)