Products 1189723-57-6
CAS 1189723-57-6 appears in our catalog under these names: Di-Beta-carbethoxyethyl-d8-methylamine, N,N-Di-(beta-carboethoxyethyl)methylamine-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, 50mg, 500 mg, 25 mg, 50 mg, 100 mg.
Ethyl 2,2,3,3-tetradeuterio-3-[methyl-(1,1,2,2-tetradeuterio-3-ethoxy-3-oxopropyl)amino]propanoate (CAS 1189723-57-6) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 239.34 g/mol. IUPAC name: ethyl 2,2,3,3-tetradeuterio-3-[methyl-(1,1,2,2-tetradeuterio-3-ethoxy-3-oxopropyl)amino]propanoate. InChIKey: OXZUPKSEIKZASL-COMRDEPKSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 239.34 g/mol |
| IUPAC name | ethyl 2,2,3,3-tetradeuterio-3-[methyl-(1,1,2,2-tetradeuterio-3-ethoxy-3-oxopropyl)amino]propanoate |
| InChIKey | OXZUPKSEIKZASL-COMRDEPKSA-N |
| SMILES | [2H]C([2H])(C(=O)OCC)C([2H])([2H])N(C)C([2H])([2H])C([2H])([2H])C(=O)OCC |
Computed by PubChem (NCBI)