Products 1189731-50-7
CAS 1189731-50-7 is the registry number for rac Deprenyl-d3. Offered by: Biosynth. Available pack sizes: 50mg, 25mg.
1-phenyl-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine (CAS 1189731-50-7) is a chemical compound with the molecular formula C13H17N and a molecular weight of 190.30 g/mol. IUPAC name: 1-phenyl-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine. InChIKey: MEZLKOACVSPNER-HPRDVNIFSA-N.
| Molecular formula | C13H17N |
|---|---|
| Molecular weight | 190.30 g/mol |
| IUPAC name | 1-phenyl-N-prop-2-ynyl-N-(trideuteriomethyl)propan-2-amine |
| InChIKey | MEZLKOACVSPNER-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N(CC#C)C(C)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)