Products 1217976-51-6
CAS 1217976-51-6 is the registry number for Selegiline-d5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-N-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynylpropan-2-amine (CAS 1217976-51-6) is a chemical compound with the molecular formula C13H17N and a molecular weight of 192.31 g/mol. IUPAC name: (2R)-N-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynylpropan-2-amine. InChIKey: MEZLKOACVSPNER-FTECLIMSSA-N.
| Molecular formula | C13H17N |
|---|---|
| Molecular weight | 192.31 g/mol |
| IUPAC name | (2R)-N-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)-N-prop-2-ynylpropan-2-amine |
| InChIKey | MEZLKOACVSPNER-FTECLIMSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C)N(C)CC#C)[2H])[2H] |
Computed by PubChem (NCBI)