Products 1189923-43-0
CAS 1189923-43-0 appears in our catalog under these names: 1-(3-Chlorophenyl)piperazine-d8, >95% (HPLC), 1-(3-Chlorophenyl)piperazine-d8. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
1-(3-chlorophenyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazine (CAS 1189923-43-0) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 204.72 g/mol. IUPAC name: 1-(3-chlorophenyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazine. InChIKey: VHFVKMTVMIZMIK-DUSUNJSHSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 204.72 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazine |
| InChIKey | VHFVKMTVMIZMIK-DUSUNJSHSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=CC(=CC=C2)Cl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)