CAS 1189924-85-3 appears in our catalog under these names: Guaifenesin-d3, rac Guaifenesin-d3, >95% (HPLC), (±)-3-(2-Methoxy-d3-phenoxy)-1,2-propanediol, 99 atom % D, min 98% Chemical Purity, Guaifenesin–d3, Guaifenesin-d3, 99.00%. Offered by: Chemat Brand, TRC, CDN, GLPBio, TargetMol. Available pack sizes: on request, 50mg, 5mg, 0,1g, 0,05g, 1mg, 500μg, 5 mg.
3-[2-(trideuteriomethoxy)phenoxy]propane-1,2-diol (CAS 1189924-85-3) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 201.23 g/mol. IUPAC name: 3-[2-(trideuteriomethoxy)phenoxy]propane-1,2-diol. InChIKey: HSRJKNPTNIJEKV-FIBGUPNXSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 201.23 g/mol |
| IUPAC name | 3-[2-(trideuteriomethoxy)phenoxy]propane-1,2-diol |
| InChIKey | HSRJKNPTNIJEKV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1OCC(CO)O |
Computed by PubChem (NCBI)