Products 61248-75-7

CAS 61248-75-7 is the registry number for (R)-guaifenesin. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

(2R)-3-(2-methoxyphenoxy)propane-1,2-diol (CAS 61248-75-7) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: (2R)-3-(2-methoxyphenoxy)propane-1,2-diol. InChIKey: HSRJKNPTNIJEKV-MRVPVSSYSA-N.

Identity
Molecular formulaC10H14O4
Molecular weight198.22 g/mol
IUPAC name(2R)-3-(2-methoxyphenoxy)propane-1,2-diol
InChIKeyHSRJKNPTNIJEKV-MRVPVSSYSA-N
SMILESCOC1=CC=CC=C1OC[C@@H](CO)O

Computed by PubChem (NCBI)