Products 1329563-41-8
CAS 1329563-41-8 appears in our catalog under these names: rac Guaifenesin-d5, >95% (HPLC), Guaifenesin-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 5 mg, 50 mg, 25 mg.
1,1,2,3,3-pentadeuterio-3-(2-methoxyphenoxy)propane-1,2-diol (CAS 1329563-41-8) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 203.25 g/mol. IUPAC name: 1,1,2,3,3-pentadeuterio-3-(2-methoxyphenoxy)propane-1,2-diol. InChIKey: HSRJKNPTNIJEKV-RORPNYJOSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 203.25 g/mol |
| IUPAC name | 1,1,2,3,3-pentadeuterio-3-(2-methoxyphenoxy)propane-1,2-diol |
| InChIKey | HSRJKNPTNIJEKV-RORPNYJOSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC=C1OC)O)O |
Computed by PubChem (NCBI)