Products 1435933-86-0
CAS 1435933-86-0 appears in our catalog under these names: Promethazine-D3 Hydrochloride 0.1 mg/ml in Dimethyl Sulfoxide (as free base), Promethazine–d3 (hydrochloride). Offered by: LoGiCal, GLPBio. Available pack sizes: 1ml, 1mg, 5mg.
N-methyl-1-phenothiazin-10-yl-N-(trideuteriomethyl)propan-2-amine;hydrochloride (CAS 1435933-86-0) is a chemical compound with the molecular formula C17H21ClN2S and a molecular weight of 323.9 g/mol. IUPAC name: N-methyl-1-phenothiazin-10-yl-N-(trideuteriomethyl)propan-2-amine;hydrochloride. InChIKey: XXPDBLUZJRXNNZ-MUTAZJQDSA-N.
| Molecular formula | C17H21ClN2S |
|---|---|
| Molecular weight | 323.9 g/mol |
| IUPAC name | N-methyl-1-phenothiazin-10-yl-N-(trideuteriomethyl)propan-2-amine;hydrochloride |
| InChIKey | XXPDBLUZJRXNNZ-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])N(C)C(C)CN1C2=CC=CC=C2SC3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)