CAS 1190253-55-4 is the registry number for 3-(1,1-Dioxidotetrahydrothiophen-3-yl)imidazolidine-2,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-dioxothiolan-3-yl)imidazolidine-2,4-dione (CAS 1190253-55-4) is a chemical compound with the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. IUPAC name: 3-(1,1-dioxothiolan-3-yl)imidazolidine-2,4-dione. InChIKey: KEMVFQYQOWNWQR-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4S |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | 3-(1,1-dioxothiolan-3-yl)imidazolidine-2,4-dione |
| InChIKey | KEMVFQYQOWNWQR-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C(=O)CNC2=O |
Computed by PubChem (NCBI)