CAS 1710202-97-3 is the registry number for Ethyl 2-methyl-2h-1,2,6-thiadiazine-4-carboxylate 1,1-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 2-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate (CAS 1710202-97-3) is a chemical compound with the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. IUPAC name: ethyl 2-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate. InChIKey: WTVFGZBVDCPSND-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4S |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | ethyl 2-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate |
| InChIKey | WTVFGZBVDCPSND-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(S(=O)(=O)N=C1)C |
Computed by PubChem (NCBI)