Products 1710202-97-3

CAS 1710202-97-3 is the registry number for Ethyl 2-methyl-2h-1,2,6-thiadiazine-4-carboxylate 1,1-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Ethyl 2-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate (CAS 1710202-97-3) is a chemical compound with the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. IUPAC name: ethyl 2-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate. InChIKey: WTVFGZBVDCPSND-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O4S
Molecular weight218.23 g/mol
IUPAC nameethyl 2-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylate
InChIKeyWTVFGZBVDCPSND-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN(S(=O)(=O)N=C1)C

Computed by PubChem (NCBI)