CAS 1248977-11-8 appears in our catalog under these names: 8-​Thia-​1,​3-​diazaspiro(4.5)​decane-​2,​4-​dione 8,​8-​dioxide, 8-Thia-1,3-diazaspiro(4.5)decane-2,4-dione 8,8-dioxide, 97%, 8lambda6-thia-1,3-diazaspiro[4.5]decane-2,4,8,8-tetrone, 97%, 97%. Offered by: Biosynth, AmBeed, Chemat. Available pack sizes: 250mg, 2,5g, 5g, 10g, 100mg, 500mg, 1g.
8,8-dioxo-8lambda6-thia-1,3-diazaspiro[4.5]decane-2,4-dione (CAS 1248977-11-8) is a chemical compound with the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. IUPAC name: 8,8-dioxo-8lambda6-thia-1,3-diazaspiro[4.5]decane-2,4-dione. InChIKey: JVWBXSSEPJUHCK-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O4S |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | 8,8-dioxo-8lambda6-thia-1,3-diazaspiro[4.5]decane-2,4-dione |
| InChIKey | JVWBXSSEPJUHCK-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC12C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)