Products 1710661-70-3

CAS 1710661-70-3 is the registry number for 2-Ethyl-5-methyl-2h-1,2,6-thiadiazine-4-carboxylic acid 1,1-dioxide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-ethyl-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid (CAS 1710661-70-3) is a chemical compound with the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. IUPAC name: 2-ethyl-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid. InChIKey: PLGREASASWPYIN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O4S
Molecular weight218.23 g/mol
IUPAC name2-ethyl-5-methyl-1,1-dioxo-1,2,6-thiadiazine-4-carboxylic acid
InChIKeyPLGREASASWPYIN-UHFFFAOYSA-N
SMILESCCN1C=C(C(=NS1(=O)=O)C)C(=O)O

Computed by PubChem (NCBI)