Products 1394041-61-2

CAS 1394041-61-2 appears in our catalog under these names: 3,5-Dimethyl-4-sulfamoyl-1H-pyrrole-2-carboxylic acid, 95%, 3,5-Dimethyl-4-sulfamoyl-1H-pyrrole-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

3,5-dimethyl-4-sulfamoyl-1H-pyrrole-2-carboxylic acid (CAS 1394041-61-2) is a chemical compound with the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. IUPAC name: 3,5-dimethyl-4-sulfamoyl-1H-pyrrole-2-carboxylic acid. InChIKey: BIAYXESWCZVSBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O4S
Molecular weight218.23 g/mol
IUPAC name3,5-dimethyl-4-sulfamoyl-1H-pyrrole-2-carboxylic acid
InChIKeyBIAYXESWCZVSBZ-UHFFFAOYSA-N
SMILESCC1=C(NC(=C1S(=O)(=O)N)C)C(=O)O

Computed by PubChem (NCBI)