Products 1190315-61-7
CAS 1190315-61-7 appears in our catalog under these names: 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine, 95%, 95%, 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine, 98%, 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine (CAS 1190315-61-7) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 3-bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine. InChIKey: PFBFXIPUSOWQGJ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 3-bromo-6-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine |
| InChIKey | PFBFXIPUSOWQGJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1C(F)(F)F)C(=CN2)Br |
Computed by PubChem (NCBI)