Products 1190317-14-6
CAS 1190317-14-6 is the registry number for Methyl 5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylate (CAS 1190317-14-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylate. InChIKey: QZVYQICELPCZOV-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 5-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylate |
| InChIKey | QZVYQICELPCZOV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(NC=C2C(=O)OC)N=C1 |
Computed by PubChem (NCBI)