CAS 1190318-30-9 appears in our catalog under these names: 4-Bromo-5-chloro-7-aza-2-oxindole, 4-Bromo-5-chloro-1H-pyrrolo[2,3-b]pyridin-2(3H)-one 97%. Offered by: TRC, Ambeed. Available pack sizes: 25mg, 100mg, 250mg, 1g.
4-bromo-5-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 1190318-30-9) is a chemical compound with the molecular formula C7H4BrClN2O and a molecular weight of 247.47 g/mol. IUPAC name: 4-bromo-5-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: QYVMKGUXHHDJPM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2O |
|---|---|
| Molecular weight | 247.47 g/mol |
| IUPAC name | 4-bromo-5-chloro-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| InChIKey | QYVMKGUXHHDJPM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CN=C2NC1=O)Cl)Br |
Computed by PubChem (NCBI)