CAS 1388057-23-5 is the registry number for 5-Bromo-6-chloro-2,3-dihydro-1H-1,3-benzodiazol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-6-chloro-1,3-dihydrobenzimidazol-2-one (CAS 1388057-23-5) is a chemical compound with the molecular formula C7H4BrClN2O and a molecular weight of 247.47 g/mol. IUPAC name: 5-bromo-6-chloro-1,3-dihydrobenzimidazol-2-one. InChIKey: KBTLCMJLOSQEDO-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2O |
|---|---|
| Molecular weight | 247.47 g/mol |
| IUPAC name | 5-bromo-6-chloro-1,3-dihydrobenzimidazol-2-one |
| InChIKey | KBTLCMJLOSQEDO-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Br)NC(=O)N2 |
Computed by PubChem (NCBI)