CAS 1248045-93-3 appears in our catalog under these names: 5-Bromo-7-chloro-1,3-benzoxazol-2-amine, 98%, 5-Bromo-7-chlorobenzo(d)oxazol-2-amine, 97%, 5-Bromo-7-chloro-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.
5-bromo-7-chloro-1,3-benzoxazol-2-amine (CAS 1248045-93-3) is a chemical compound with the molecular formula C7H4BrClN2O and a molecular weight of 247.47 g/mol. IUPAC name: 5-bromo-7-chloro-1,3-benzoxazol-2-amine. InChIKey: WKSJMJXQUPOKLW-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2O |
|---|---|
| Molecular weight | 247.47 g/mol |
| IUPAC name | 5-bromo-7-chloro-1,3-benzoxazol-2-amine |
| InChIKey | WKSJMJXQUPOKLW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(O2)N)Cl)Br |
Computed by PubChem (NCBI)