CAS 64037-08-7 is the registry number for 6-bromo-5-chloro-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromo-5-chloro-1,3-benzoxazol-2-amine (CAS 64037-08-7) is a chemical compound with the molecular formula C7H4BrClN2O and a molecular weight of 247.47 g/mol. IUPAC name: 6-bromo-5-chloro-1,3-benzoxazol-2-amine. InChIKey: PEEJUZZCANIEIL-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2O |
|---|---|
| Molecular weight | 247.47 g/mol |
| IUPAC name | 6-bromo-5-chloro-1,3-benzoxazol-2-amine |
| InChIKey | PEEJUZZCANIEIL-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Br)OC(=N2)N |
Computed by PubChem (NCBI)