CAS 1247830-45-0 appears in our catalog under these names: 7-Bromo-5-chloro-1,3-benzoxazol-2-amine, 95%, 7-Bromo-5-chloro-1,3-benzoxazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 100mg.
7-bromo-5-chloro-1,3-benzoxazol-2-amine (CAS 1247830-45-0) is a chemical compound with the molecular formula C7H4BrClN2O and a molecular weight of 247.47 g/mol. IUPAC name: 7-bromo-5-chloro-1,3-benzoxazol-2-amine. InChIKey: BOHZBFNIVHFFAC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2O |
|---|---|
| Molecular weight | 247.47 g/mol |
| IUPAC name | 7-bromo-5-chloro-1,3-benzoxazol-2-amine |
| InChIKey | BOHZBFNIVHFFAC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(O2)N)Br)Cl |
Computed by PubChem (NCBI)