Products 1190320-16-1
CAS 1190320-16-1 is the registry number for 3-Bromo-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-bromo-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine (CAS 1190320-16-1) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 3-bromo-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine. InChIKey: IPMFTOAKMLJDLY-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | IPMFTOAKMLJDLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC=C2Br)C(F)(F)F |
Computed by PubChem (NCBI)