Products 1190440-62-0
CAS 1190440-62-0 is the registry number for 2-Oxo-1,2,5,6,7,8-hexahydro-1,6-naphthyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-oxo-5,6,7,8-tetrahydro-1H-1,6-naphthyridine-3-carbonitrile (CAS 1190440-62-0) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 2-oxo-5,6,7,8-tetrahydro-1H-1,6-naphthyridine-3-carbonitrile. InChIKey: GSVRQIWIPOMDRZ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 2-oxo-5,6,7,8-tetrahydro-1H-1,6-naphthyridine-3-carbonitrile |
| InChIKey | GSVRQIWIPOMDRZ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC(=O)C(=C2)C#N |
Computed by PubChem (NCBI)