Products 119061-18-6
CAS 119061-18-6 appears in our catalog under these names: 2-(4-Chlorophenoxy)-2-phenylacetic acid, 2-(4-Chlorophenoxy)-2-phenylacetic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 50mg, 100mg, 500mg, 1g.
2-(4-chlorophenoxy)-2-phenylacetic acid (CAS 119061-18-6) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 2-(4-chlorophenoxy)-2-phenylacetic acid. InChIKey: NGUVKIVGNXLBQE-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 2-(4-chlorophenoxy)-2-phenylacetic acid |
| InChIKey | NGUVKIVGNXLBQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)