Products 1190713-19-9

CAS 1190713-19-9 is the registry number for Butyl piperazine-1-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Butyl piperazine-1-carboxylate;hydrochloride (CAS 1190713-19-9) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: butyl piperazine-1-carboxylate;hydrochloride. InChIKey: VHYKUGOYPWERLD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19ClN2O2
Molecular weight222.71 g/mol
IUPAC namebutyl piperazine-1-carboxylate;hydrochloride
InChIKeyVHYKUGOYPWERLD-UHFFFAOYSA-N
SMILESCCCCOC(=O)N1CCNCC1.Cl

Computed by PubChem (NCBI)