CAS 119162-48-0 is the registry number for 3-(4-Nitrophenyl)-1,2-oxazol-5-amine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(4-nitrophenyl)-1,2-oxazol-5-amine (CAS 119162-48-0) is a chemical compound with the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. IUPAC name: 3-(4-nitrophenyl)-1,2-oxazol-5-amine. InChIKey: FBFFBDKIJDJYKM-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O3 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 3-(4-nitrophenyl)-1,2-oxazol-5-amine |
| InChIKey | FBFFBDKIJDJYKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)