CAS 119162-49-1 appears in our catalog under these names: 3-(2-Fluorophenyl)-1,2-oxazol-5-amine, 95%, 3-(2-Fluorophenyl)isoxazol-5-amine, 95+%, 3-(2-Fluorophenyl)-1,2-oxazol-5-amine, 3-(2-Fluorophenyl)-1,2-oxazol-5-amine, 95%, 95%, 3-(2-Fluorophenyl)-1,2-oxazol-5-amine, 95+%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g, 50mg, 500mg.
3-(2-fluorophenyl)-1,2-oxazol-5-amine (CAS 119162-49-1) is a chemical compound with the molecular formula C9H7FN2O and a molecular weight of 178.16 g/mol. IUPAC name: 3-(2-fluorophenyl)-1,2-oxazol-5-amine. InChIKey: DQVWIGYSQYJUKI-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 3-(2-fluorophenyl)-1,2-oxazol-5-amine |
| InChIKey | DQVWIGYSQYJUKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=C2)N)F |
Computed by PubChem (NCBI)