Products 1192107-39-3
CAS 1192107-39-3 appears in our catalog under these names: 4-(Methoxymethyl)-2,6-dimethylphenylboronic acid, 95%, (4-(Methoxymethyl)-2,6-dimethylphenyl)boronic acid, ≥95%, 4-(Methoxymethyl)-2,6-dimethylphenylboronic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g.
[4-(methoxymethyl)-2,6-dimethylphenyl]boronic acid (CAS 1192107-39-3) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: [4-(methoxymethyl)-2,6-dimethylphenyl]boronic acid. InChIKey: SBMDYQPCRGUBMW-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | [4-(methoxymethyl)-2,6-dimethylphenyl]boronic acid |
| InChIKey | SBMDYQPCRGUBMW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)COC)C)(O)O |
Computed by PubChem (NCBI)