Products 119229-96-8
CAS 119229-96-8 is the registry number for MAO-A inhibitor 1, 98.55%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 10 mg, 50 mg, 5 mg.
6-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,2,4-triol (CAS 119229-96-8) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 6-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,2,4-triol. InChIKey: WREAQMXXCUARJD-DAFODLJHSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 6-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,2,4-triol |
| InChIKey | WREAQMXXCUARJD-DAFODLJHSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=C(C(=CC(=C2)O)O)O)O |
Computed by PubChem (NCBI)