Products 1192350-47-2
CAS 1192350-47-2 appears in our catalog under these names: (R)–2–Amino–2–(naphthalen–1–yl)acetic acid hydrochloride, (R)-2-Amino-2-(naphthalen-1-yl)acetic acid hydrochloride, 97%, (R)-2-Amino-2-(naphthalen-1-yl)acetic acid hydrochloride, 97%, 97%, (R)-H-2-(Nap-1-yl)-Gly-OH HCl, 97%. Offered by: GLPBio, Fluorochem, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-naphthalen-1-ylacetic acid;hydrochloride (CAS 1192350-47-2) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: (2R)-2-amino-2-naphthalen-1-ylacetic acid;hydrochloride. InChIKey: GVSANNROGBIDFD-RFVHGSKJSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | (2R)-2-amino-2-naphthalen-1-ylacetic acid;hydrochloride |
| InChIKey | GVSANNROGBIDFD-RFVHGSKJSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)