Products 221692-28-0
CAS 221692-28-0 appears in our catalog under these names: 6-(2-Chloroacetyl)-1-methyl-1,2,3,4-tetrahydroquinolin-2-one, 95%, 6-(2-Chloroacetyl)-1-methyl-1,2,3,4-tetrahydroquinolin-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
6-(2-chloroacetyl)-1-methyl-3,4-dihydroquinolin-2-one (CAS 221692-28-0) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 6-(2-chloroacetyl)-1-methyl-3,4-dihydroquinolin-2-one. InChIKey: MQDJHRBDWKGNMX-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 6-(2-chloroacetyl)-1-methyl-3,4-dihydroquinolin-2-one |
| InChIKey | MQDJHRBDWKGNMX-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CCC2=C1C=CC(=C2)C(=O)CCl |
Computed by PubChem (NCBI)