Products 223632-69-7
CAS 223632-69-7 appears in our catalog under these names: 1-(3-Chlorobenzoyl)-4-piperidinone, 95%, 1-(3-Chlorobenzoyl)-4-piperidinone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 10000mg.
1-(3-chlorobenzoyl)piperidin-4-one (CAS 223632-69-7) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 1-(3-chlorobenzoyl)piperidin-4-one. InChIKey: FVKASFKQQYXBBV-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 1-(3-chlorobenzoyl)piperidin-4-one |
| InChIKey | FVKASFKQQYXBBV-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)