CAS 697793-63-8 is the registry number for 2-Chloro-6,7-dimethoxy-4-methylquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
2-chloro-6,7-dimethoxy-4-methylquinoline (CAS 697793-63-8) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 2-chloro-6,7-dimethoxy-4-methylquinoline. InChIKey: JWSDOYINPAVDIM-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 2-chloro-6,7-dimethoxy-4-methylquinoline |
| InChIKey | JWSDOYINPAVDIM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=CC(=C(C=C12)OC)OC)Cl |
Computed by PubChem (NCBI)