CAS 380611-11-0 is the registry number for 2-Amino-2-(naphthalen-1-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
2-amino-2-naphthalen-1-ylacetic acid;hydrochloride (CAS 380611-11-0) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 2-amino-2-naphthalen-1-ylacetic acid;hydrochloride. InChIKey: GVSANNROGBIDFD-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 2-amino-2-naphthalen-1-ylacetic acid;hydrochloride |
| InChIKey | GVSANNROGBIDFD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)