Products 380611-11-0

CAS 380611-11-0 is the registry number for 2-Amino-2-(naphthalen-1-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2-amino-2-naphthalen-1-ylacetic acid;hydrochloride (CAS 380611-11-0) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 2-amino-2-naphthalen-1-ylacetic acid;hydrochloride. InChIKey: GVSANNROGBIDFD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12ClNO2
Molecular weight237.68 g/mol
IUPAC name2-amino-2-naphthalen-1-ylacetic acid;hydrochloride
InChIKeyGVSANNROGBIDFD-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2C(C(=O)O)N.Cl

Computed by PubChem (NCBI)