CAS 1607016-34-1 appears in our catalog under these names: Methyl 2-amino-2-(2,4-dimethoxyphenyl)acetate hydrochloride, 95%, Methyl 2-amino-2-(2,4-dimethoxyphenyl)acetate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-amino-2-(2,4-dimethoxyphenyl)acetate;hydrochloride (CAS 1607016-34-1) is a chemical compound with the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. IUPAC name: methyl 2-amino-2-(2,4-dimethoxyphenyl)acetate;hydrochloride. InChIKey: UFHFDSXVNNQTQO-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO4 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | methyl 2-amino-2-(2,4-dimethoxyphenyl)acetate;hydrochloride |
| InChIKey | UFHFDSXVNNQTQO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(C(=O)OC)N)OC.Cl |
Computed by PubChem (NCBI)