Products 1193387-19-7
CAS 1193387-19-7 appears in our catalog under these names: N-(3-Amino-2,6-dimethylphenyl)acetamide hydrochloride, 95%, N-(3-Amino-2,6-dimethylphenyl)acetamide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(3-amino-2,6-dimethylphenyl)acetamide;hydrochloride (CAS 1193387-19-7) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: N-(3-amino-2,6-dimethylphenyl)acetamide;hydrochloride. InChIKey: OLBHDKBIMWJSNI-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | N-(3-amino-2,6-dimethylphenyl)acetamide;hydrochloride |
| InChIKey | OLBHDKBIMWJSNI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)N)C)NC(=O)C.Cl |
Computed by PubChem (NCBI)