Products 1193388-85-0
CAS 1193388-85-0 appears in our catalog under these names: 1-[(Dimethylcarbamoyl)methyl]-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-((Dimethylcarbamoyl)methyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 1-((Dimethylcarbamoyl)methyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-[2-(dimethylamino)-2-oxoethyl]triazole-4-carboxylic acid (CAS 1193388-85-0) is a chemical compound with the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. IUPAC name: 1-[2-(dimethylamino)-2-oxoethyl]triazole-4-carboxylic acid. InChIKey: KPQKNPZQTZXPIY-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O3 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | 1-[2-(dimethylamino)-2-oxoethyl]triazole-4-carboxylic acid |
| InChIKey | KPQKNPZQTZXPIY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CN1C=C(N=N1)C(=O)O |
Computed by PubChem (NCBI)