Products 60797-68-4
CAS 60797-68-4 appears in our catalog under these names: Theophylline Impurity 7, Doxofylline Impurity 32, Theophylline-ethylenediamine Impurity 9, N-(5-amino-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)formamide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-(5-amino-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)formamide (CAS 60797-68-4) is a chemical compound with the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. IUPAC name: N-(5-amino-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)formamide. InChIKey: AFHLUZWQEROWAW-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O3 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | N-(5-amino-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)formamide |
| InChIKey | AFHLUZWQEROWAW-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)N)NC=O |
Computed by PubChem (NCBI)