Products 1597448-46-8
CAS 1597448-46-8 appears in our catalog under these names: Caffeine Impurity 11, Theobromine Carboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 10mg.
[3-methyl-5-(methylamino)imidazole-4-carbonyl]carbamic acid (CAS 1597448-46-8) is a chemical compound with the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. IUPAC name: [3-methyl-5-(methylamino)imidazole-4-carbonyl]carbamic acid. InChIKey: BCFQLJFGMUXHBS-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O3 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | [3-methyl-5-(methylamino)imidazole-4-carbonyl]carbamic acid |
| InChIKey | BCFQLJFGMUXHBS-UHFFFAOYSA-N |
| SMILES | CNC1=C(N(C=N1)C)C(=O)NC(=O)O |
Computed by PubChem (NCBI)