CAS 681492-82-0 is the registry number for (2-Methyl-6-nitro-2,3-dihydroimidazo[2,1-b]oxazol-2-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanamine (CAS 681492-82-0) is a chemical compound with the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. IUPAC name: (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanamine. InChIKey: KKADWYSFHHSULS-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O3 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanamine |
| InChIKey | KKADWYSFHHSULS-UHFFFAOYSA-N |
| SMILES | CC1(CN2C=C(N=C2O1)[N+](=O)[O-])CN |
Computed by PubChem (NCBI)