CAS 55782-76-8 is the registry number for Caffeine Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-methylformamide (CAS 55782-76-8) is a chemical compound with the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. IUPAC name: N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-methylformamide. InChIKey: NAFROSSUTOOOGG-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O3 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-methylformamide |
| InChIKey | NAFROSSUTOOOGG-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(NC1=O)N)N(C)C=O |
Computed by PubChem (NCBI)