CAS 1194048-60-6 is the registry number for Aminopyralid-13C2,15N. Offered by: TRC. Available pack sizes: 25mg.
4-amino-3,6-dichloro(2,6-13C2,115N)pyridine-2-carboxylic acid (CAS 1194048-60-6) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 209.99 g/mol. IUPAC name: 4-amino-3,6-dichloro(2,6-13C2,115N)pyridine-2-carboxylic acid. InChIKey: NIXXQNOQHKNPEJ-SWAGCQKESA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 4-amino-3,6-dichloro(2,6-13C2,115N)pyridine-2-carboxylic acid |
| InChIKey | NIXXQNOQHKNPEJ-SWAGCQKESA-N |
| SMILES | C1=C(C(=[13C]([15N]=[13C]1Cl)C(=O)O)Cl)N |
Computed by PubChem (NCBI)